N-butyl-N-[(furan-2-yl)methyl]-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-butyl-N-[(furan-2-yl)methyl]-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide
N-butyl-N-[(furan-2-yl)methyl]-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G008-2585 |
| Compound Name: | N-butyl-N-[(furan-2-yl)methyl]-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide |
| Molecular Weight: | 388.48 |
| Molecular Formula: | C20 H24 N2 O4 S |
| Smiles: | CCCCN(Cc1ccco1)S(c1cc(ccc1C)c1cc(C)no1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6874 |
| logD: | 4.6874 |
| logSw: | -4.2815 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.683 |
| InChI Key: | CLLNLCHTDZWLKU-UHFFFAOYSA-N |