N-(5-chloropyridin-2-yl)-5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(5-chloropyridin-2-yl)-5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
N-(5-chloropyridin-2-yl)-5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | G008-4154 |
| Compound Name: | N-(5-chloropyridin-2-yl)-5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 355.82 |
| Molecular Formula: | C13 H10 Cl N3 O3 S2 |
| Smiles: | Cc1cc(c2ccc(s2)S(Nc2ccc(cn2)[Cl])(=O)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.5857 |
| logD: | 1.7834 |
| logSw: | -3.756 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.953 |
| InChI Key: | KNKJGJXHKBUYHB-UHFFFAOYSA-N |