1-[2-ethyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonyl]-4-[3-(trifluoromethyl)phenyl]piperazine
Chemical Structure Depiction of
1-[2-ethyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonyl]-4-[3-(trifluoromethyl)phenyl]piperazine
1-[2-ethyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonyl]-4-[3-(trifluoromethyl)phenyl]piperazine
Compound characteristics
| Compound ID: | G008-4675 |
| Compound Name: | 1-[2-ethyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| Molecular Weight: | 479.52 |
| Molecular Formula: | C23 H24 F3 N3 O3 S |
| Smiles: | CCc1ccc(cc1S(N1CCN(CC1)c1cccc(c1)C(F)(F)F)(=O)=O)c1cc(C)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.1549 |
| logD: | 5.1549 |
| logSw: | -5.2275 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 56.551 |
| InChI Key: | ARBKNQOEIIOMCF-UHFFFAOYSA-N |