N-[(3,4-dimethoxyphenyl)methyl]-5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N-[(3,4-dimethoxyphenyl)methyl]-5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonamide
N-[(3,4-dimethoxyphenyl)methyl]-5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | G008-5499 |
| Compound Name: | N-[(3,4-dimethoxyphenyl)methyl]-5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 432.49 |
| Molecular Formula: | C21 H24 N2 O6 S |
| Smiles: | Cc1c(C)noc1c1ccc(c(c1)S(NCc1ccc(c(c1)OC)OC)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.3094 |
| logD: | 3.3091 |
| logSw: | -3.6612 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.233 |
| InChI Key: | GWATXXJPTBQDSD-UHFFFAOYSA-N |