rel-(3aR,6aS)-1-(2,5-dimethylphenyl)-3-[(3-fluorophenyl)methyl]tetrahydro-5lambda~6~-thieno[3,4-d]imidazole-2,5,5(1H,3H)-trione
Chemical Structure Depiction of
rel-(3aR,6aS)-1-(2,5-dimethylphenyl)-3-[(3-fluorophenyl)methyl]tetrahydro-5lambda~6~-thieno[3,4-d]imidazole-2,5,5(1H,3H)-trione
rel-(3aR,6aS)-1-(2,5-dimethylphenyl)-3-[(3-fluorophenyl)methyl]tetrahydro-5lambda~6~-thieno[3,4-d]imidazole-2,5,5(1H,3H)-trione
Compound characteristics
| Compound ID: | G012-0485 |
| Compound Name: | rel-(3aR,6aS)-1-(2,5-dimethylphenyl)-3-[(3-fluorophenyl)methyl]tetrahydro-5lambda~6~-thieno[3,4-d]imidazole-2,5,5(1H,3H)-trione |
| Molecular Weight: | 388.46 |
| Molecular Formula: | C20 H21 F N2 O3 S |
| Smiles: | Cc1ccc(C)c(c1)N1C(N(Cc2cccc(c2)F)[C@@H]2CS(C[C@H]12)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 3.0241 |
| logD: | 3.0241 |
| logSw: | -3.2575 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.272 |
| InChI Key: | VPICTBGFCZYDGT-UHFFFAOYSA-N |