N-[(2,4-dimethoxyphenyl)methyl]-1-[5-(pyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
N-[(2,4-dimethoxyphenyl)methyl]-1-[5-(pyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]-1H-pyrrole-2-carboxamide
N-[(2,4-dimethoxyphenyl)methyl]-1-[5-(pyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | G015-0366 |
| Compound Name: | N-[(2,4-dimethoxyphenyl)methyl]-1-[5-(pyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl]-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 413.5 |
| Molecular Formula: | C20 H23 N5 O3 S |
| Smiles: | COc1ccc(CNC(c2cccn2c2nnc(N3CCCC3)s2)=O)c(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.8472 |
| logD: | 3.8472 |
| logSw: | -3.9721 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.827 |
| InChI Key: | IGNYELMSVZZFOV-UHFFFAOYSA-N |