8-(ethanesulfonyl)-3-methyl-2-oxo-N-[3-(4-propylpiperazin-1-yl)propyl]-1-oxa-8-azaspiro[4.5]dec-3-ene-4-carboxamide
Chemical Structure Depiction of
8-(ethanesulfonyl)-3-methyl-2-oxo-N-[3-(4-propylpiperazin-1-yl)propyl]-1-oxa-8-azaspiro[4.5]dec-3-ene-4-carboxamide
8-(ethanesulfonyl)-3-methyl-2-oxo-N-[3-(4-propylpiperazin-1-yl)propyl]-1-oxa-8-azaspiro[4.5]dec-3-ene-4-carboxamide
Compound characteristics
| Compound ID: | G016-1393 |
| Compound Name: | 8-(ethanesulfonyl)-3-methyl-2-oxo-N-[3-(4-propylpiperazin-1-yl)propyl]-1-oxa-8-azaspiro[4.5]dec-3-ene-4-carboxamide |
| Molecular Weight: | 470.63 |
| Molecular Formula: | C22 H38 N4 O5 S |
| Smiles: | CCCN1CCN(CCCNC(C2=C(C)C(=O)OC23CCN(CC3)S(CC)(=O)=O)=O)CC1 |
| Stereo: | ACHIRAL |
| logP: | 0.4942 |
| logD: | -0.4705 |
| logSw: | -1.4037 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.776 |
| InChI Key: | PJCHPEPBOXAVAC-UHFFFAOYSA-N |