4-{(3-methoxypropyl)[(thiophen-2-yl)methyl]sulfamoyl}thiophene-2-carboxamide
Chemical Structure Depiction of
4-{(3-methoxypropyl)[(thiophen-2-yl)methyl]sulfamoyl}thiophene-2-carboxamide
4-{(3-methoxypropyl)[(thiophen-2-yl)methyl]sulfamoyl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | G017-4235 |
| Compound Name: | 4-{(3-methoxypropyl)[(thiophen-2-yl)methyl]sulfamoyl}thiophene-2-carboxamide |
| Molecular Weight: | 374.5 |
| Molecular Formula: | C14 H18 N2 O4 S3 |
| Smiles: | COCCCN(Cc1cccs1)S(c1cc(C(N)=O)sc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6623 |
| logD: | 1.6623 |
| logSw: | -2.572 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.03 |
| InChI Key: | HDKLTCVJVHRFAH-UHFFFAOYSA-N |