8-(4-tert-butylbenzene-1-sulfonyl)-2-(ethylsulfanyl)-3-(4-methylphenyl)-1,4,8-triazaspiro[4.5]deca-1,3-diene
Chemical Structure Depiction of
8-(4-tert-butylbenzene-1-sulfonyl)-2-(ethylsulfanyl)-3-(4-methylphenyl)-1,4,8-triazaspiro[4.5]deca-1,3-diene
8-(4-tert-butylbenzene-1-sulfonyl)-2-(ethylsulfanyl)-3-(4-methylphenyl)-1,4,8-triazaspiro[4.5]deca-1,3-diene
Compound characteristics
| Compound ID: | G022-0238 |
| Compound Name: | 8-(4-tert-butylbenzene-1-sulfonyl)-2-(ethylsulfanyl)-3-(4-methylphenyl)-1,4,8-triazaspiro[4.5]deca-1,3-diene |
| Molecular Weight: | 483.69 |
| Molecular Formula: | C26 H33 N3 O2 S2 |
| Smiles: | CCSC1C(c2ccc(C)cc2)=NC2(CCN(CC2)S(c2ccc(cc2)C(C)(C)C)(=O)=O)N=1 |
| Stereo: | ACHIRAL |
| logP: | 6.1523 |
| logD: | 6.1523 |
| logSw: | -5.613 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 48.871 |
| InChI Key: | BOHWKSTVGDXUJI-UHFFFAOYSA-N |