3-(2-fluorophenyl)-5-[5-methyl-1-(3-methylphenyl)-1H-1,2,3-triazol-4-yl]-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(2-fluorophenyl)-5-[5-methyl-1-(3-methylphenyl)-1H-1,2,3-triazol-4-yl]-1,2,4-oxadiazole
3-(2-fluorophenyl)-5-[5-methyl-1-(3-methylphenyl)-1H-1,2,3-triazol-4-yl]-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | G026-0141 |
| Compound Name: | 3-(2-fluorophenyl)-5-[5-methyl-1-(3-methylphenyl)-1H-1,2,3-triazol-4-yl]-1,2,4-oxadiazole |
| Molecular Weight: | 335.34 |
| Molecular Formula: | C18 H14 F N5 O |
| Smiles: | Cc1cccc(c1)n1c(C)c(c2nc(c3ccccc3F)no2)nn1 |
| Stereo: | ACHIRAL |
| logP: | 3.9569 |
| logD: | 3.9569 |
| logSw: | -4.1632 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 58.487 |
| InChI Key: | RCSNITPUUUWZRM-UHFFFAOYSA-N |