5-{3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-oxopropane-1-sulfonyl}-1-methyl-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
5-{3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-oxopropane-1-sulfonyl}-1-methyl-1,3-dihydro-2H-indol-2-one
5-{3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-oxopropane-1-sulfonyl}-1-methyl-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | G069-0079 |
| Compound Name: | 5-{3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-oxopropane-1-sulfonyl}-1-methyl-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 455.58 |
| Molecular Formula: | C24 H29 N3 O4 S |
| Smiles: | Cc1cccc(c1C)N1CCN(CC1)C(CCS(c1ccc2c(CC(N2C)=O)c1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3548 |
| logD: | 2.3547 |
| logSw: | -2.7123 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 64.139 |
| InChI Key: | DOZZKGFCXPVHAT-UHFFFAOYSA-N |