ethyl 4-(4-{[(3-methoxyphenyl)methyl]carbamoyl}piperidine-1-sulfonyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 4-(4-{[(3-methoxyphenyl)methyl]carbamoyl}piperidine-1-sulfonyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate
ethyl 4-(4-{[(3-methoxyphenyl)methyl]carbamoyl}piperidine-1-sulfonyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | G070-0124 |
| Compound Name: | ethyl 4-(4-{[(3-methoxyphenyl)methyl]carbamoyl}piperidine-1-sulfonyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 477.58 |
| Molecular Formula: | C23 H31 N3 O6 S |
| Smiles: | CCOC(c1c(c(C)[nH]c1C)S(N1CCC(CC1)C(NCc1cccc(c1)OC)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0673 |
| logD: | 2.0673 |
| logSw: | -2.7058 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 95.448 |
| InChI Key: | PEWQKZZRGCRIEJ-UHFFFAOYSA-N |