ethyl 2,5-dimethyl-4-(4-{[2-(3-methylthiophen-2-yl)ethyl]carbamoyl}piperidine-1-sulfonyl)-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 2,5-dimethyl-4-(4-{[2-(3-methylthiophen-2-yl)ethyl]carbamoyl}piperidine-1-sulfonyl)-1H-pyrrole-3-carboxylate
ethyl 2,5-dimethyl-4-(4-{[2-(3-methylthiophen-2-yl)ethyl]carbamoyl}piperidine-1-sulfonyl)-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | G070-0204 |
| Compound Name: | ethyl 2,5-dimethyl-4-(4-{[2-(3-methylthiophen-2-yl)ethyl]carbamoyl}piperidine-1-sulfonyl)-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 481.63 |
| Molecular Formula: | C22 H31 N3 O5 S2 |
| Smiles: | CCOC(c1c(c(C)[nH]c1C)S(N1CCC(CC1)C(NCCc1c(C)ccs1)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5662 |
| logD: | 2.5662 |
| logSw: | -2.8528 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 88.764 |
| InChI Key: | HACYPLTYBGRGNJ-UHFFFAOYSA-N |