ethyl 4-({2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl}sulfamoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 4-({2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl}sulfamoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate
ethyl 4-({2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl}sulfamoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | G070-0777 |
| Compound Name: | ethyl 4-({2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl}sulfamoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 466.53 |
| Molecular Formula: | C21 H27 F N4 O5 S |
| Smiles: | CCOC(c1c(c(C)[nH]c1C)S(NCC(N1CCN(CC1)c1ccccc1F)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8934 |
| logD: | 1.8884 |
| logSw: | -2.5163 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 92.89 |
| InChI Key: | DPSLDAFDKVXZAM-UHFFFAOYSA-N |