ethyl 2,5-dimethyl-4-{[(3-methylphenyl)methyl]sulfamoyl}-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 2,5-dimethyl-4-{[(3-methylphenyl)methyl]sulfamoyl}-1H-pyrrole-3-carboxylate
ethyl 2,5-dimethyl-4-{[(3-methylphenyl)methyl]sulfamoyl}-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | G070-0982 |
| Compound Name: | ethyl 2,5-dimethyl-4-{[(3-methylphenyl)methyl]sulfamoyl}-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 350.43 |
| Molecular Formula: | C17 H22 N2 O4 S |
| Smiles: | CCOC(c1c(c(C)[nH]c1C)S(NCc1cccc(C)c1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0626 |
| logD: | 3.061 |
| logSw: | -3.3055 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.538 |
| InChI Key: | CKKSYPKJTRRGMZ-UHFFFAOYSA-N |