ethyl 4-{[(2-ethoxyphenyl)methyl]sulfamoyl}-1,2,5-trimethyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 4-{[(2-ethoxyphenyl)methyl]sulfamoyl}-1,2,5-trimethyl-1H-pyrrole-3-carboxylate
ethyl 4-{[(2-ethoxyphenyl)methyl]sulfamoyl}-1,2,5-trimethyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | G070-1106 |
| Compound Name: | ethyl 4-{[(2-ethoxyphenyl)methyl]sulfamoyl}-1,2,5-trimethyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 394.49 |
| Molecular Formula: | C19 H26 N2 O5 S |
| Smiles: | CCOC(c1c(c(C)n(C)c1C)S(NCc1ccccc1OCC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5975 |
| logD: | 2.596 |
| logSw: | -3.0323 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.74 |
| InChI Key: | WNDQONGYHARAAL-UHFFFAOYSA-N |