6-(4-ethoxyphenyl)-N-(3-methoxypropyl)-3-phenyl-2H-pyrazolo[3,4-b]pyridine-4-carboxamide
Chemical Structure Depiction of
6-(4-ethoxyphenyl)-N-(3-methoxypropyl)-3-phenyl-2H-pyrazolo[3,4-b]pyridine-4-carboxamide
6-(4-ethoxyphenyl)-N-(3-methoxypropyl)-3-phenyl-2H-pyrazolo[3,4-b]pyridine-4-carboxamide
Compound characteristics
| Compound ID: | G111-0020 |
| Compound Name: | 6-(4-ethoxyphenyl)-N-(3-methoxypropyl)-3-phenyl-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| Molecular Weight: | 430.51 |
| Molecular Formula: | C25 H26 N4 O3 |
| Smiles: | CCOc1ccc(cc1)c1cc(C(NCCCOC)=O)c2c(n1)n[nH]c2c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.9944 |
| logD: | 4.9935 |
| logSw: | -4.7134 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.876 |
| InChI Key: | LCFRKVVKYJITJP-UHFFFAOYSA-N |