6-{[4-methoxy-3-(3-phenylpyrrolidine-1-sulfonyl)phenyl]methyl}-5H-pyrrolo[3,4-b]pyridine-5,7(6H)-dione
Chemical Structure Depiction of
6-{[4-methoxy-3-(3-phenylpyrrolidine-1-sulfonyl)phenyl]methyl}-5H-pyrrolo[3,4-b]pyridine-5,7(6H)-dione
6-{[4-methoxy-3-(3-phenylpyrrolidine-1-sulfonyl)phenyl]methyl}-5H-pyrrolo[3,4-b]pyridine-5,7(6H)-dione
Compound characteristics
| Compound ID: | G115-0046 |
| Compound Name: | 6-{[4-methoxy-3-(3-phenylpyrrolidine-1-sulfonyl)phenyl]methyl}-5H-pyrrolo[3,4-b]pyridine-5,7(6H)-dione |
| Molecular Weight: | 477.54 |
| Molecular Formula: | C25 H23 N3 O5 S |
| Smiles: | COc1ccc(CN2C(c3cccnc3C2=O)=O)cc1S(N1CCC(C1)c1ccccc1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6035 |
| logD: | 2.6035 |
| logSw: | -3.2701 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 78.77 |
| InChI Key: | PQVLWZHBOXGOSA-LJQANCHMSA-N |