N-(2-fluorophenyl)-4-[2-(5-methoxy-1H-indol-3-yl)-2-oxoethyl]piperazine-1-carboxamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-4-[2-(5-methoxy-1H-indol-3-yl)-2-oxoethyl]piperazine-1-carboxamide
N-(2-fluorophenyl)-4-[2-(5-methoxy-1H-indol-3-yl)-2-oxoethyl]piperazine-1-carboxamide
Compound characteristics
| Compound ID: | G117-0295 |
| Compound Name: | N-(2-fluorophenyl)-4-[2-(5-methoxy-1H-indol-3-yl)-2-oxoethyl]piperazine-1-carboxamide |
| Molecular Weight: | 410.45 |
| Molecular Formula: | C22 H23 F N4 O3 |
| Smiles: | COc1ccc2c(c1)c(c[nH]2)C(CN1CCN(CC1)C(Nc1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8599 |
| logD: | 2.7776 |
| logSw: | -3.5069 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.212 |
| InChI Key: | YJSNUPUUUULCLJ-UHFFFAOYSA-N |