N-[(3-methoxyphenyl)methyl]-4-[4-(methylsulfanyl)phenyl]-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carboxamide
Chemical Structure Depiction of
N-[(3-methoxyphenyl)methyl]-4-[4-(methylsulfanyl)phenyl]-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carboxamide
N-[(3-methoxyphenyl)methyl]-4-[4-(methylsulfanyl)phenyl]-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carboxamide
Compound characteristics
| Compound ID: | G118-0559 |
| Compound Name: | N-[(3-methoxyphenyl)methyl]-4-[4-(methylsulfanyl)phenyl]-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carboxamide |
| Molecular Weight: | 469.61 |
| Molecular Formula: | C28 H27 N3 O2 S |
| Smiles: | COc1cccc(CNC(N2Cc3ccccc3n3cccc3C2c2ccc(cc2)SC)=O)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.3396 |
| logD: | 6.3396 |
| logSw: | -5.5477 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.437 |
| InChI Key: | ZZPJZYAUKCNJFU-HHHXNRCGSA-N |