ethyl 4-{[(4-phenyl-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carbonyl)amino]methyl}cyclohexane-1-carboxylate
					Chemical Structure Depiction of
ethyl 4-{[(4-phenyl-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carbonyl)amino]methyl}cyclohexane-1-carboxylate
			ethyl 4-{[(4-phenyl-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carbonyl)amino]methyl}cyclohexane-1-carboxylate
Compound characteristics
| Compound ID: | G118-0987 | 
| Compound Name: | ethyl 4-{[(4-phenyl-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carbonyl)amino]methyl}cyclohexane-1-carboxylate | 
| Molecular Weight: | 471.6 | 
| Molecular Formula: | C29 H33 N3 O3 | 
| Smiles: | CCOC(C1CCC(CC1)CNC(N1Cc2ccccc2n2cccc2C1c1ccccc1)=O)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 6.3257 | 
| logD: | 6.3257 | 
| logSw: | -5.6058 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 48.839 | 
| InChI Key: | UBOLDIYVGGRJGJ-AISLOGHRSA-N | 
 
				 
				