4-(3-chlorophenyl)-N-(2-phenylethyl)-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carboxamide
Chemical Structure Depiction of
4-(3-chlorophenyl)-N-(2-phenylethyl)-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carboxamide
4-(3-chlorophenyl)-N-(2-phenylethyl)-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carboxamide
Compound characteristics
| Compound ID: | G118-1946 |
| Compound Name: | 4-(3-chlorophenyl)-N-(2-phenylethyl)-4H-pyrrolo[1,2-a][1,4]benzodiazepine-5(6H)-carboxamide |
| Molecular Weight: | 441.96 |
| Molecular Formula: | C27 H24 Cl N3 O |
| Smiles: | C(CNC(N1Cc2ccccc2n2cccc2C1c1cccc(c1)[Cl])=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.5425 |
| logD: | 6.5425 |
| logSw: | -6.4119 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 27.7347 |
| InChI Key: | XINSGPLFLDBIJC-AREMUKBSSA-N |