N-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyl-2,3-dimethyl-1H-indole-5-carboxamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyl-2,3-dimethyl-1H-indole-5-carboxamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyl-2,3-dimethyl-1H-indole-5-carboxamide
Compound characteristics
| Compound ID: | G119-0665 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyl-2,3-dimethyl-1H-indole-5-carboxamide |
| Molecular Weight: | 380.49 |
| Molecular Formula: | C23 H28 N2 O3 |
| Smiles: | CCn1c(C)c(C)c2cc(ccc12)C(NCCc1ccc(c(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5393 |
| logD: | 3.5393 |
| logSw: | -3.7209 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.951 |
| InChI Key: | OXDXCAUWSCYGQP-UHFFFAOYSA-N |