1-benzyl-2,3-dimethyl-N-(1-phenylethyl)-1H-indole-5-carboxamide
Chemical Structure Depiction of
1-benzyl-2,3-dimethyl-N-(1-phenylethyl)-1H-indole-5-carboxamide
1-benzyl-2,3-dimethyl-N-(1-phenylethyl)-1H-indole-5-carboxamide
Compound characteristics
| Compound ID: | G119-1004 |
| Compound Name: | 1-benzyl-2,3-dimethyl-N-(1-phenylethyl)-1H-indole-5-carboxamide |
| Molecular Weight: | 382.5 |
| Molecular Formula: | C26 H26 N2 O |
| Smiles: | CC(c1ccccc1)NC(c1ccc2c(c1)c(C)c(C)n2Cc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5124 |
| logD: | 5.5124 |
| logSw: | -5.5688 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.0155 |
| InChI Key: | HMVQOXNUBYTADH-IBGZPJMESA-N |