1-[(4-chlorophenyl)methyl]-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dimethyl-1H-indole-5-carboxamide
Chemical Structure Depiction of
1-[(4-chlorophenyl)methyl]-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dimethyl-1H-indole-5-carboxamide
1-[(4-chlorophenyl)methyl]-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dimethyl-1H-indole-5-carboxamide
Compound characteristics
| Compound ID: | G119-1672 |
| Compound Name: | 1-[(4-chlorophenyl)methyl]-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dimethyl-1H-indole-5-carboxamide |
| Molecular Weight: | 488.07 |
| Molecular Formula: | C30 H34 Cl N3 O |
| Smiles: | CCN(CCCNC(c1ccc2c(c1)c(C)c(C)n2Cc1ccc(cc1)[Cl])=O)c1cccc(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 6.9963 |
| logD: | 6.9679 |
| logSw: | -6.3871 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.6837 |
| InChI Key: | VSUJGFHKJSRXDN-UHFFFAOYSA-N |