N-(2-methoxy-5-methylphenyl)-2,3,3a,4-tetrahydropyrrolo[1,2-a]quinoxaline-5(1H)-carboxamide
Chemical Structure Depiction of
N-(2-methoxy-5-methylphenyl)-2,3,3a,4-tetrahydropyrrolo[1,2-a]quinoxaline-5(1H)-carboxamide
N-(2-methoxy-5-methylphenyl)-2,3,3a,4-tetrahydropyrrolo[1,2-a]quinoxaline-5(1H)-carboxamide
Compound characteristics
| Compound ID: | G120-0410 |
| Compound Name: | N-(2-methoxy-5-methylphenyl)-2,3,3a,4-tetrahydropyrrolo[1,2-a]quinoxaline-5(1H)-carboxamide |
| Molecular Weight: | 337.42 |
| Molecular Formula: | C20 H23 N3 O2 |
| Smiles: | Cc1ccc(c(c1)NC(N1CC2CCCN2c2ccccc12)=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7807 |
| logD: | 3.7807 |
| logSw: | -3.9009 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.231 |
| InChI Key: | FLEOSWHRLZHUPU-OAHLLOKOSA-N |