methyl 1-[(2-chlorophenyl)methyl]-7-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylate
Chemical Structure Depiction of
methyl 1-[(2-chlorophenyl)methyl]-7-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylate
methyl 1-[(2-chlorophenyl)methyl]-7-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylate
Compound characteristics
| Compound ID: | G141-0193 |
| Compound Name: | methyl 1-[(2-chlorophenyl)methyl]-7-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylate |
| Molecular Weight: | 342.78 |
| Molecular Formula: | C18 H15 Cl N2 O3 |
| Smiles: | Cc1ccc2C(C(=CN(Cc3ccccc3[Cl])c2n1)C(=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9513 |
| logD: | 3.9513 |
| logSw: | -4.2551 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.442 |
| InChI Key: | RPQKMQCDUOCWJD-UHFFFAOYSA-N |