ethyl 5-{3-[(2H-1,3-benzodioxol-5-yl)sulfamoyl]-4-methoxyphenyl}-1,2-oxazole-3-carboxylate
Chemical Structure Depiction of
ethyl 5-{3-[(2H-1,3-benzodioxol-5-yl)sulfamoyl]-4-methoxyphenyl}-1,2-oxazole-3-carboxylate
ethyl 5-{3-[(2H-1,3-benzodioxol-5-yl)sulfamoyl]-4-methoxyphenyl}-1,2-oxazole-3-carboxylate
Compound characteristics
| Compound ID: | G189-2156 |
| Compound Name: | ethyl 5-{3-[(2H-1,3-benzodioxol-5-yl)sulfamoyl]-4-methoxyphenyl}-1,2-oxazole-3-carboxylate |
| Molecular Weight: | 446.43 |
| Molecular Formula: | C20 H18 N2 O8 S |
| Smiles: | CCOC(c1cc(c2ccc(c(c2)S(Nc2ccc3c(c2)OCO3)(=O)=O)OC)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.374 |
| logD: | 2.9618 |
| logSw: | -3.7095 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 107.923 |
| InChI Key: | LTMXNKGZHVIDBG-UHFFFAOYSA-N |