1-(3-fluorophenyl)-3-{[(4-methoxyphenyl)methyl]amino}pyrazin-2(1H)-one
Chemical Structure Depiction of
1-(3-fluorophenyl)-3-{[(4-methoxyphenyl)methyl]amino}pyrazin-2(1H)-one
1-(3-fluorophenyl)-3-{[(4-methoxyphenyl)methyl]amino}pyrazin-2(1H)-one
Compound characteristics
| Compound ID: | G194-0103 |
| Compound Name: | 1-(3-fluorophenyl)-3-{[(4-methoxyphenyl)methyl]amino}pyrazin-2(1H)-one |
| Molecular Weight: | 325.34 |
| Molecular Formula: | C18 H16 F N3 O2 |
| Smiles: | COc1ccc(CNC2C(N(C=CN=2)c2cccc(c2)F)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.7358 |
| logD: | 1.7357 |
| logSw: | -2.1062 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.845 |
| InChI Key: | KGRGJDFXTZVGHW-UHFFFAOYSA-N |