1-(3,5-dimethylphenyl)-3-{[(4-methylphenyl)methyl]amino}pyrazin-2(1H)-one
Chemical Structure Depiction of
1-(3,5-dimethylphenyl)-3-{[(4-methylphenyl)methyl]amino}pyrazin-2(1H)-one
1-(3,5-dimethylphenyl)-3-{[(4-methylphenyl)methyl]amino}pyrazin-2(1H)-one
Compound characteristics
| Compound ID: | G194-0250 |
| Compound Name: | 1-(3,5-dimethylphenyl)-3-{[(4-methylphenyl)methyl]amino}pyrazin-2(1H)-one |
| Molecular Weight: | 319.4 |
| Molecular Formula: | C20 H21 N3 O |
| Smiles: | Cc1ccc(CNC2C(N(C=CN=2)c2cc(C)cc(C)c2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.1608 |
| logD: | 3.1605 |
| logSw: | -3.119 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.301 |
| InChI Key: | HKMNUAPKUUZOMU-UHFFFAOYSA-N |