3-(benzylamino)-1-(3-chloro-4-methylphenyl)pyrazin-2(1H)-one
Chemical Structure Depiction of
3-(benzylamino)-1-(3-chloro-4-methylphenyl)pyrazin-2(1H)-one
3-(benzylamino)-1-(3-chloro-4-methylphenyl)pyrazin-2(1H)-one
Compound characteristics
| Compound ID: | G194-0463 |
| Compound Name: | 3-(benzylamino)-1-(3-chloro-4-methylphenyl)pyrazin-2(1H)-one |
| Molecular Weight: | 325.8 |
| Molecular Formula: | C18 H16 Cl N3 O |
| Smiles: | Cc1ccc(cc1[Cl])N1C=CN=C(C1=O)NCc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 2.9328 |
| logD: | 2.9324 |
| logSw: | -3.37 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.301 |
| InChI Key: | KNYAZSAXVGMDKA-UHFFFAOYSA-N |