2-{[4-(4-fluorophenyl)-3-oxo-3,4-dihydropyrazin-2-yl]sulfanyl}-N-(4-methylphenyl)acetamide
Chemical Structure Depiction of
2-{[4-(4-fluorophenyl)-3-oxo-3,4-dihydropyrazin-2-yl]sulfanyl}-N-(4-methylphenyl)acetamide
2-{[4-(4-fluorophenyl)-3-oxo-3,4-dihydropyrazin-2-yl]sulfanyl}-N-(4-methylphenyl)acetamide
Compound characteristics
| Compound ID: | G195-0277 |
| Compound Name: | 2-{[4-(4-fluorophenyl)-3-oxo-3,4-dihydropyrazin-2-yl]sulfanyl}-N-(4-methylphenyl)acetamide |
| Molecular Weight: | 369.42 |
| Molecular Formula: | C19 H16 F N3 O2 S |
| Smiles: | Cc1ccc(cc1)NC(CSC1C(N(C=CN=1)c1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5649 |
| logD: | 2.5649 |
| logSw: | -2.9083 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.792 |
| InChI Key: | HLYRSOFPNRXZCW-UHFFFAOYSA-N |