3-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-1-(4-ethoxyphenyl)pyrazin-2(1H)-one
Chemical Structure Depiction of
3-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-1-(4-ethoxyphenyl)pyrazin-2(1H)-one
3-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-1-(4-ethoxyphenyl)pyrazin-2(1H)-one
Compound characteristics
| Compound ID: | G195-0936 |
| Compound Name: | 3-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-1-(4-ethoxyphenyl)pyrazin-2(1H)-one |
| Molecular Weight: | 390.86 |
| Molecular Formula: | C19 H16 Cl F N2 O2 S |
| Smiles: | CCOc1ccc(cc1)N1C=CN=C(C1=O)SCc1ccc(cc1[Cl])F |
| Stereo: | ACHIRAL |
| logP: | 3.9832 |
| logD: | 3.9832 |
| logSw: | -4.2408 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 30.7663 |
| InChI Key: | ZXTNGOPFOCQESX-UHFFFAOYSA-N |