1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-{[(2-methylphenyl)methyl]sulfanyl}pyrazin-2(1H)-one
Chemical Structure Depiction of
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-{[(2-methylphenyl)methyl]sulfanyl}pyrazin-2(1H)-one
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-{[(2-methylphenyl)methyl]sulfanyl}pyrazin-2(1H)-one
Compound characteristics
| Compound ID: | G195-0953 |
| Compound Name: | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-{[(2-methylphenyl)methyl]sulfanyl}pyrazin-2(1H)-one |
| Molecular Weight: | 366.44 |
| Molecular Formula: | C20 H18 N2 O3 S |
| Smiles: | Cc1ccccc1CSC1C(N(C=CN=1)c1ccc2c(c1)OCCO2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6252 |
| logD: | 2.6252 |
| logSw: | -2.8548 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 39.466 |
| InChI Key: | YWSSNGCSHPJQRL-UHFFFAOYSA-N |