3-(benzylsulfanyl)-1-(2-methoxy-5-methylphenyl)pyrazin-2(1H)-one
Chemical Structure Depiction of
3-(benzylsulfanyl)-1-(2-methoxy-5-methylphenyl)pyrazin-2(1H)-one
3-(benzylsulfanyl)-1-(2-methoxy-5-methylphenyl)pyrazin-2(1H)-one
Compound characteristics
| Compound ID: | G195-0980 |
| Compound Name: | 3-(benzylsulfanyl)-1-(2-methoxy-5-methylphenyl)pyrazin-2(1H)-one |
| Molecular Weight: | 338.43 |
| Molecular Formula: | C19 H18 N2 O2 S |
| Smiles: | Cc1ccc(c(c1)N1C=CN=C(C1=O)SCc1ccccc1)OC |
| Stereo: | ACHIRAL |
| logP: | 2.7833 |
| logD: | 2.7833 |
| logSw: | -3.1502 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 30.9722 |
| InChI Key: | ZYLNUJBYYIQLRJ-UHFFFAOYSA-N |