4-(benzenesulfonyl)-1-[(3-methylphenyl)methyl]-3-(methylsulfanyl)-1H-pyrazol-5-amine
Chemical Structure Depiction of
4-(benzenesulfonyl)-1-[(3-methylphenyl)methyl]-3-(methylsulfanyl)-1H-pyrazol-5-amine
4-(benzenesulfonyl)-1-[(3-methylphenyl)methyl]-3-(methylsulfanyl)-1H-pyrazol-5-amine
Compound characteristics
| Compound ID: | G196-0242F |
| Compound Name: | 4-(benzenesulfonyl)-1-[(3-methylphenyl)methyl]-3-(methylsulfanyl)-1H-pyrazol-5-amine |
| Molecular Weight: | 373.49 |
| Molecular Formula: | C18 H19 N3 O2 S2 |
| Smiles: | Cc1cccc(Cn2c(c(c(n2)SC)S(c2ccccc2)(=O)=O)N)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.3309 |
| logD: | 3.3309 |
| logSw: | -3.6477 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.827 |
| InChI Key: | PIKOEGLRXNEUKI-UHFFFAOYSA-N |