2-{[1-(4-ethylphenyl)-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-N-[3-(methylsulfanyl)phenyl]acetamide
Chemical Structure Depiction of
2-{[1-(4-ethylphenyl)-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-N-[3-(methylsulfanyl)phenyl]acetamide
2-{[1-(4-ethylphenyl)-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-N-[3-(methylsulfanyl)phenyl]acetamide
Compound characteristics
| Compound ID: | G219-0607 |
| Compound Name: | 2-{[1-(4-ethylphenyl)-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-N-[3-(methylsulfanyl)phenyl]acetamide |
| Molecular Weight: | 446.57 |
| Molecular Formula: | C25 H26 N4 O2 S |
| Smiles: | CCc1ccc(cc1)n1c2c(c(C)cc(n2)OCC(Nc2cccc(c2)SC)=O)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.9459 |
| logD: | 5.9459 |
| logSw: | -5.7535 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.911 |
| InChI Key: | SJZHMXVXXWLVNP-UHFFFAOYSA-N |