2-{[1-(4-ethylphenyl)-3-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-N-[(4-fluorophenyl)methyl]acetamide
Chemical Structure Depiction of
2-{[1-(4-ethylphenyl)-3-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-N-[(4-fluorophenyl)methyl]acetamide
2-{[1-(4-ethylphenyl)-3-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-N-[(4-fluorophenyl)methyl]acetamide
Compound characteristics
| Compound ID: | G219-3987 |
| Compound Name: | 2-{[1-(4-ethylphenyl)-3-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-N-[(4-fluorophenyl)methyl]acetamide |
| Molecular Weight: | 486.47 |
| Molecular Formula: | C25 H22 F4 N4 O2 |
| Smiles: | CCc1ccc(cc1)n1c2c(c(cc(n2)OCC(NCc2ccc(cc2)F)=O)C(F)(F)F)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.5437 |
| logD: | 5.5437 |
| logSw: | -5.6697 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.234 |
| InChI Key: | BSQZDFSFUFTIBG-UHFFFAOYSA-N |