N-[(2-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-(trifluoromethyl)aniline
Chemical Structure Depiction of
N-[(2-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-(trifluoromethyl)aniline
N-[(2-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-(trifluoromethyl)aniline
Compound characteristics
| Compound ID: | G221-0615 |
| Compound Name: | N-[(2-fluorophenyl)(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-(trifluoromethyl)aniline |
| Molecular Weight: | 413.37 |
| Molecular Formula: | C22 H15 F4 N3 O |
| Smiles: | c1ccc(cc1)c1nnc(C(c2ccccc2F)Nc2cccc(c2)C(F)(F)F)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9095 |
| logD: | 5.9095 |
| logSw: | -6.2748 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.069 |
| InChI Key: | GPWOPSTVHLWBQG-LJQANCHMSA-N |