1-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl](phenyl)methyl}-4-phenylpiperazine
Chemical Structure Depiction of
1-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl](phenyl)methyl}-4-phenylpiperazine
1-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl](phenyl)methyl}-4-phenylpiperazine
Compound characteristics
| Compound ID: | G221-0999 |
| Compound Name: | 1-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl](phenyl)methyl}-4-phenylpiperazine |
| Molecular Weight: | 430.94 |
| Molecular Formula: | C25 H23 Cl N4 O |
| Smiles: | C1CN(CCN1C(c1ccccc1)c1nnc(c2ccc(cc2)[Cl])o1)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.619 |
| logD: | 5.619 |
| logSw: | -6.3542 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.768 |
| InChI Key: | WNCNPHVLQKNTTE-HSZRJFAPSA-N |