methyl 3-[(2,5-dimethoxyphenyl)sulfamoyl]thiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-[(2,5-dimethoxyphenyl)sulfamoyl]thiophene-2-carboxylate
methyl 3-[(2,5-dimethoxyphenyl)sulfamoyl]thiophene-2-carboxylate
Compound characteristics
| Compound ID: | G225-0041 |
| Compound Name: | methyl 3-[(2,5-dimethoxyphenyl)sulfamoyl]thiophene-2-carboxylate |
| Molecular Weight: | 357.4 |
| Molecular Formula: | C14 H15 N O6 S2 |
| Smiles: | COC(c1c(ccs1)S(Nc1cc(ccc1OC)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3821 |
| logD: | 2.2233 |
| logSw: | -2.9099 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.557 |
| InChI Key: | XGDPRGOISKDIIC-UHFFFAOYSA-N |