methyl 3-[4-(3-methoxyphenyl)piperazine-1-sulfonyl]thiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-[4-(3-methoxyphenyl)piperazine-1-sulfonyl]thiophene-2-carboxylate
methyl 3-[4-(3-methoxyphenyl)piperazine-1-sulfonyl]thiophene-2-carboxylate
Compound characteristics
| Compound ID: | G225-0072 |
| Compound Name: | methyl 3-[4-(3-methoxyphenyl)piperazine-1-sulfonyl]thiophene-2-carboxylate |
| Molecular Weight: | 396.48 |
| Molecular Formula: | C17 H20 N2 O5 S2 |
| Smiles: | COC(c1c(ccs1)S(N1CCN(CC1)c1cccc(c1)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7032 |
| logD: | 2.7032 |
| logSw: | -3.1274 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 64.946 |
| InChI Key: | DXAPKMCPNNKCFE-UHFFFAOYSA-N |