methyl 3-(4-benzylpiperazine-1-sulfonyl)-4-phenylthiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-(4-benzylpiperazine-1-sulfonyl)-4-phenylthiophene-2-carboxylate
methyl 3-(4-benzylpiperazine-1-sulfonyl)-4-phenylthiophene-2-carboxylate
Compound characteristics
| Compound ID: | G225-0241 |
| Compound Name: | methyl 3-(4-benzylpiperazine-1-sulfonyl)-4-phenylthiophene-2-carboxylate |
| Molecular Weight: | 456.58 |
| Molecular Formula: | C23 H24 N2 O4 S2 |
| Smiles: | COC(c1c(c(cs1)c1ccccc1)S(N1CCN(CC1)Cc1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8451 |
| logD: | 3.8382 |
| logSw: | -3.9307 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 57.41 |
| InChI Key: | CNRICDKRFNRCHZ-UHFFFAOYSA-N |