methyl 3-[(2-amino-2-oxoethyl)(phenyl)sulfamoyl]thiophene-2-carboxylate
					Chemical Structure Depiction of
methyl 3-[(2-amino-2-oxoethyl)(phenyl)sulfamoyl]thiophene-2-carboxylate
			methyl 3-[(2-amino-2-oxoethyl)(phenyl)sulfamoyl]thiophene-2-carboxylate
Compound characteristics
| Compound ID: | G225-0368 | 
| Compound Name: | methyl 3-[(2-amino-2-oxoethyl)(phenyl)sulfamoyl]thiophene-2-carboxylate | 
| Molecular Weight: | 354.4 | 
| Molecular Formula: | C14 H14 N2 O5 S2 | 
| Smiles: | COC(c1c(ccs1)S(N(CC(N)=O)c1ccccc1)(=O)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 1.1758 | 
| logD: | 1.1758 | 
| logSw: | -2.2505 | 
| Hydrogen bond acceptors count: | 9 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 87.644 | 
| InChI Key: | FGCDORQUFZDETQ-UHFFFAOYSA-N | 
 
				 
				