methyl 3-[(2-amino-2-oxoethyl)(4-methylphenyl)sulfamoyl]thiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-[(2-amino-2-oxoethyl)(4-methylphenyl)sulfamoyl]thiophene-2-carboxylate
methyl 3-[(2-amino-2-oxoethyl)(4-methylphenyl)sulfamoyl]thiophene-2-carboxylate
Compound characteristics
| Compound ID: | G225-0408 |
| Compound Name: | methyl 3-[(2-amino-2-oxoethyl)(4-methylphenyl)sulfamoyl]thiophene-2-carboxylate |
| Molecular Weight: | 368.43 |
| Molecular Formula: | C15 H16 N2 O5 S2 |
| Smiles: | Cc1ccc(cc1)N(CC(N)=O)S(c1ccsc1C(=O)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7208 |
| logD: | 1.7208 |
| logSw: | -2.4282 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.644 |
| InChI Key: | CYRHEDCUVLDIBE-UHFFFAOYSA-N |