methyl 3-[(2-fluorophenyl)sulfamoyl]-1-benzothiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-[(2-fluorophenyl)sulfamoyl]-1-benzothiophene-2-carboxylate
methyl 3-[(2-fluorophenyl)sulfamoyl]-1-benzothiophene-2-carboxylate
Compound characteristics
| Compound ID: | G226-0030 |
| Compound Name: | methyl 3-[(2-fluorophenyl)sulfamoyl]-1-benzothiophene-2-carboxylate |
| Molecular Weight: | 365.4 |
| Molecular Formula: | C16 H12 F N O4 S2 |
| Smiles: | COC(c1c(c2ccccc2s1)S(Nc1ccccc1F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7214 |
| logD: | 2.9412 |
| logSw: | -4.138 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.111 |
| InChI Key: | CVHGCBRQWOKSIT-UHFFFAOYSA-N |