ethyl 3-[(3-chloro-2-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate
Chemical Structure Depiction of
ethyl 3-[(3-chloro-2-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate
ethyl 3-[(3-chloro-2-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate
Compound characteristics
| Compound ID: | G226-0102 |
| Compound Name: | ethyl 3-[(3-chloro-2-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate |
| Molecular Weight: | 409.91 |
| Molecular Formula: | C18 H16 Cl N O4 S2 |
| Smiles: | CCOC(c1c(c2ccccc2s1)S(Nc1cccc(c1C)[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1551 |
| logD: | 4.1733 |
| logSw: | -5.4801 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.691 |
| InChI Key: | WXBWSOXSRSUWFK-UHFFFAOYSA-N |