methyl 3-{[(2-chlorophenyl)methyl]sulfamoyl}-4-fluoro-1-benzothiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-{[(2-chlorophenyl)methyl]sulfamoyl}-4-fluoro-1-benzothiophene-2-carboxylate
methyl 3-{[(2-chlorophenyl)methyl]sulfamoyl}-4-fluoro-1-benzothiophene-2-carboxylate
Compound characteristics
| Compound ID: | G226-0531 |
| Compound Name: | methyl 3-{[(2-chlorophenyl)methyl]sulfamoyl}-4-fluoro-1-benzothiophene-2-carboxylate |
| Molecular Weight: | 413.87 |
| Molecular Formula: | C17 H13 Cl F N O4 S2 |
| Smiles: | COC(c1c(c2c(cccc2s1)F)S(NCc1ccccc1[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3768 |
| logD: | 4.3753 |
| logSw: | -4.3824 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.917 |
| InChI Key: | CNFGVZYUQDNFFW-UHFFFAOYSA-N |