methyl 3-[(2-anilino-2-oxoethyl)(methyl)sulfamoyl]-1-benzothiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-[(2-anilino-2-oxoethyl)(methyl)sulfamoyl]-1-benzothiophene-2-carboxylate
methyl 3-[(2-anilino-2-oxoethyl)(methyl)sulfamoyl]-1-benzothiophene-2-carboxylate
Compound characteristics
| Compound ID: | G226-0791 |
| Compound Name: | methyl 3-[(2-anilino-2-oxoethyl)(methyl)sulfamoyl]-1-benzothiophene-2-carboxylate |
| Molecular Weight: | 418.49 |
| Molecular Formula: | C19 H18 N2 O5 S2 |
| Smiles: | CN(CC(Nc1ccccc1)=O)S(c1c2ccccc2sc1C(=O)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0965 |
| logD: | 3.0964 |
| logSw: | -3.4296 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.873 |
| InChI Key: | BAPFSDBTNPEAJJ-UHFFFAOYSA-N |