4-(2H-1,3-benzodioxol-5-yl)-4'-(3,4-dimethylphenyl)-2,2'-bi-1,3-thiazole
Chemical Structure Depiction of
4-(2H-1,3-benzodioxol-5-yl)-4'-(3,4-dimethylphenyl)-2,2'-bi-1,3-thiazole
4-(2H-1,3-benzodioxol-5-yl)-4'-(3,4-dimethylphenyl)-2,2'-bi-1,3-thiazole
Compound characteristics
| Compound ID: | G227-1641 |
| Compound Name: | 4-(2H-1,3-benzodioxol-5-yl)-4'-(3,4-dimethylphenyl)-2,2'-bi-1,3-thiazole |
| Molecular Weight: | 392.5 |
| Molecular Formula: | C21 H16 N2 O2 S2 |
| Smiles: | Cc1ccc(cc1C)c1csc(c2nc(cs2)c2ccc3c(c2)OCO3)n1 |
| Stereo: | ACHIRAL |
| logP: | 7.164 |
| logD: | 7.164 |
| logSw: | -5.7908 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.55 |
| InChI Key: | GPDBRUDZGCLNHF-UHFFFAOYSA-N |